About 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid)
2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) (PubChem CID 54202090) has the molecular formula C18H16N2O2S3
and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid).
Molecular Properties
| Compound Name | 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) |
| PubChem CID | 54202090 |
| Molecular Formula | C18H16N2O2S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) |
| SMILES | O=C(S)CC(C(=O)S)c1nc2c(NCc3ccccc3)cccc2s1 |
| InChI | InChI=1S/C18H16N2O2S3/c21-15(23)9-12(18(22)24)17-20-16-13(7-4-8-14(16)25-17)19-10-11-5-2-1-3-6-11/h1-8,12,19H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | PPYYNXNKDKTHER-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid)?
The IUPAC name of 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) (CID 54202090) is 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid).
What is the SMILES notation for 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid)?
The canonical SMILES for 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) is O=C(S)CC(C(=O)S)c1nc2c(NCc3ccccc3)cccc2s1.
What is the InChIKey of 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid)?
The InChIKey is PPYYNXNKDKTHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2S3/c21-15(23)9-12(18(22)24)17-20-16-13(7-4-8-14(16)25-17)19-10-11-5-2-1-3-6-11/h1-8,12,19H,9-10H2,(H,21,23)(H,22,24).
What are the key properties of 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid)?
2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) has a molecular weight of 388.54 g/mol, XLogP of 4.29, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) is sourced from PubChem (CID 54202090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).