C18H16N2O2S3 — CID 54202090
2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) (PubChem CID 54202090) has the molecular formula C18H16N2O2S3 and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid).
| Compound Name | 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) |
|---|---|
| PubChem CID | 54202090 |
| Molecular Formula | C18H16N2O2S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-[4-(benzylamino)-1,3-benzothiazol-2-yl]butanebis(thioic S-acid) |
| SMILES | O=C(S)CC(C(=O)S)c1nc2c(NCc3ccccc3)cccc2s1 |
| InChI | InChI=1S/C18H16N2O2S3/c21-15(23)9-12(18(22)24)17-20-16-13(7-4-8-14(16)25-17)19-10-11-5-2-1-3-6-11/h1-8,12,19H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | PPYYNXNKDKTHER-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|