C19H31N3O2S3 — CID 173357231
2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(2-methylpropan-1-amine) (PubChem CID 173357231) has the molecular formula C19H31N3O2S3 and a molecular weight of 429.68 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(2-methylpropan-1-amine).
| Compound Name | 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(2-methylpropan-1-amine) |
|---|---|
| PubChem CID | 173357231 |
| Molecular Formula | C19H31N3O2S3 |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(2-methylpropan-1-amine) |
| SMILES | CC(C)CN.CC(C)CN.O=C(S)CC(C(=O)S)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9NO2S3.2C4H11N/c13-9(15)5-6(11(14)16)10-12-7-3-1-2-4-8(7)17-10;2*1-4(2)3-5/h1-4,6H,5H2,(H,13,15)(H,14,16);2*4H,3,5H2,1-2H3 |
| InChIKey | HAJQICKAYMBCOK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|