C11H7CaNO3S2 — CID 18967026
calcium 2-(1,3-benzothiazol-2-yl)-4-oxo-4-sulfidobutanoate (PubChem CID 18967026) has the molecular formula C11H7CaNO3S2 and a molecular weight of 305.39 g/mol. Its IUPAC name is calcium 2-(1,3-benzothiazol-2-yl)-4-oxo-4-sulfidobutanoate.
| Compound Name | calcium 2-(1,3-benzothiazol-2-yl)-4-oxo-4-sulfidobutanoate |
|---|---|
| PubChem CID | 18967026 |
| Molecular Formula | C11H7CaNO3S2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | calcium 2-(1,3-benzothiazol-2-yl)-4-oxo-4-sulfidobutanoate |
| SMILES | O=C([S-])CC(C(=O)[O-])c1nc2ccccc2s1.[Ca+2] |
| InChI | InChI=1S/C11H9NO3S2.Ca/c13-9(16)5-6(11(14)15)10-12-7-3-1-2-4-8(7)17-10;/h1-4,6H,5H2,(H,13,16)(H,14,15);/q;+2/p-2 |
| InChIKey | KYADFVCTNILWCE-UHFFFAOYSA-L |
| XLogP | 0.21 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|