potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate

C14H12KNO6S — CID 23697535

IUPACpotassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate
SMILESCC(=O)OC(C(=O)[O-])C(OC(C)=O)c1nc2ccccc2s1.[K+]
InChIInChI=1S/C14H13NO6S.K/c1-7(16)20-11(12(14(18)19)21-8(2)17)13-15-9-5-3-4-6-10(9)22-13;/h3-6,11-12H,1-2H3,(H,18,19);/q;+1/p-1
InChIKeyKANPLFQFGBGSQT-UHFFFAOYSA-M
MW361.42 g/mol
LogP-2.41
Rot. Bonds5

About potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate

potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate (PubChem CID 23697535) has the molecular formula C14H12KNO6S and a molecular weight of 361.42 g/mol. Its IUPAC name is potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate.

Molecular Properties

Compound Namepotassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate
PubChem CID23697535
Molecular FormulaC14H12KNO6S
Molecular Weight361.42 g/mol
Exact Mass361.00
IUPAC Namepotassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate
SMILESCC(=O)OC(C(=O)[O-])C(OC(C)=O)c1nc2ccccc2s1.[K+]
InChIInChI=1S/C14H13NO6S.K/c1-7(16)20-11(12(14(18)19)21-8(2)17)13-15-9-5-3-4-6-10(9)22-13;/h3-6,11-12H,1-2H3,(H,18,19);/q;+1/p-1
InChIKeyKANPLFQFGBGSQT-UHFFFAOYSA-M
XLogP-2.41
TPSA105.62 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500361.42
LogP ≤ 5-2.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate?
The IUPAC name of potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate (CID 23697535) is potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate.
What is the SMILES notation for potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate?
The canonical SMILES for potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate is CC(=O)OC(C(=O)[O-])C(OC(C)=O)c1nc2ccccc2s1.[K+].
What is the InChIKey of potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate?
The InChIKey is KANPLFQFGBGSQT-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H13NO6S.K/c1-7(16)20-11(12(14(18)19)21-8(2)17)13-15-9-5-3-4-6-10(9)22-13;/h3-6,11-12H,1-2H3,(H,18,19);/q;+1/p-1.
What are the key properties of potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate?
potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate has a molecular weight of 361.42 g/mol, XLogP of -2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoate is sourced from PubChem (CID 23697535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).