C14H13NO3S2Zn — CID 88519591
zinc 3-(1,3-benzothiazol-2-yl)-4-methyl-3-sulfidocarbonylpentanoate (PubChem CID 88519591) has the molecular formula C14H13NO3S2Zn and a molecular weight of 372.79 g/mol. Its IUPAC name is zinc 3-(1,3-benzothiazol-2-yl)-4-methyl-3-sulfidocarbonylpentanoate.
| Compound Name | zinc 3-(1,3-benzothiazol-2-yl)-4-methyl-3-sulfidocarbonylpentanoate |
|---|---|
| PubChem CID | 88519591 |
| Molecular Formula | C14H13NO3S2Zn |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | zinc 3-(1,3-benzothiazol-2-yl)-4-methyl-3-sulfidocarbonylpentanoate |
| SMILES | CC(C)C(CC(=O)[O-])(C(=O)[S-])c1nc2ccccc2s1.[Zn+2] |
| InChI | InChI=1S/C14H15NO3S2.Zn/c1-8(2)14(13(18)19,7-11(16)17)12-15-9-5-3-4-6-10(9)20-12;/h3-6,8H,7H2,1-2H3,(H,16,17)(H,18,19);/q;+2/p-2 |
| InChIKey | MPWXXHZVILUCTQ-UHFFFAOYSA-L |
| XLogP | 1.40 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|