C12H11N3OS2 — CID 57138060
2-(1,3-benzothiazol-2-yl)-2-cyano-3-sulfanylbutanamide (PubChem CID 57138060) has the molecular formula C12H11N3OS2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-cyano-3-sulfanylbutanamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-cyano-3-sulfanylbutanamide |
|---|---|
| PubChem CID | 57138060 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-cyano-3-sulfanylbutanamide |
| SMILES | CC(S)C(C#N)(C(N)=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H11N3OS2/c1-7(17)12(6-13,10(14)16)11-15-8-4-2-3-5-9(8)18-11/h2-5,7,17H,1H3,(H2,14,16) |
| InChIKey | NQVKNVSNXHLPPM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|