C9H11N3OS2 — CID 175000494
2-methyl-1,3-benzothiazole;sulfanylurea (PubChem CID 175000494) has the molecular formula C9H11N3OS2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-methyl-1,3-benzothiazole;sulfanylurea.
| Compound Name | 2-methyl-1,3-benzothiazole;sulfanylurea |
|---|---|
| PubChem CID | 175000494 |
| Molecular Formula | C9H11N3OS2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-methyl-1,3-benzothiazole;sulfanylurea |
| SMILES | Cc1nc2ccccc2s1.NC(=O)NS |
| InChI | InChI=1S/C8H7NS.CH4N2OS/c1-6-9-7-4-2-3-5-8(7)10-6;2-1(4)3-5/h2-5H,1H3;5H,(H3,2,3,4) |
| InChIKey | GRXHNXXVIOBJSP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|