C15H14BrNS — CID 161475855
bromomethylbenzene;2-methyl-1,3-benzothiazole (PubChem CID 161475855) has the molecular formula C15H14BrNS and a molecular weight of 320.26 g/mol. Its IUPAC name is bromomethylbenzene;2-methyl-1,3-benzothiazole.
| Compound Name | bromomethylbenzene;2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 161475855 |
| Molecular Formula | C15H14BrNS |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | bromomethylbenzene;2-methyl-1,3-benzothiazole |
| SMILES | BrCc1ccccc1.Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS.C7H7Br/c1-6-9-7-4-2-3-5-8(7)10-6;8-6-7-4-2-1-3-5-7/h2-5H,1H3;1-5H,6H2 |
| InChIKey | WDRWFBHSDGXRSL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|