C8H9NO3PS+ — CID 68800497
dihydroxy(oxo)phosphanium;2-methyl-1,3-benzothiazole (PubChem CID 68800497) has the molecular formula C8H9NO3PS+ and a molecular weight of 230.20 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-methyl-1,3-benzothiazole.
| Compound Name | dihydroxy(oxo)phosphanium;2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 68800497 |
| Molecular Formula | C8H9NO3PS+ |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2ccccc2s1.O=[P+](O)O |
| InChI | InChI=1S/C8H7NS.HO3P/c1-6-9-7-4-2-3-5-8(7)10-6;1-4(2)3/h2-5H,1H3;(H-,1,2,3)/p+1 |
| InChIKey | IZVVDSNTQRDJNO-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|