C14H14N2S — CID 160647860
2-methyl-1,3-benzothiazole;2-methylpyridine (PubChem CID 160647860) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-methyl-1,3-benzothiazole;2-methylpyridine.
| Compound Name | 2-methyl-1,3-benzothiazole;2-methylpyridine |
|---|---|
| PubChem CID | 160647860 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-methyl-1,3-benzothiazole;2-methylpyridine |
| SMILES | Cc1ccccn1.Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS.C6H7N/c1-6-9-7-4-2-3-5-8(7)10-6;1-6-4-2-3-5-7-6/h2-5H,1H3;2-5H,1H3 |
| InChIKey | RKAHLGKKKFBZMX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |