About dichloroplatinum;bis(2-methylpyridine)
dichloroplatinum;bis(2-methylpyridine) (PubChem CID 4034453) has the molecular formula C12H14Cl2N2Pt
and a molecular weight of 452.24 g/mol. Its IUPAC name is dichloroplatinum;bis(2-methylpyridine).
Molecular Properties
| Compound Name | dichloroplatinum;bis(2-methylpyridine) |
| PubChem CID | 4034453 |
| Molecular Formula | C12H14Cl2N2Pt |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | dichloroplatinum;bis(2-methylpyridine) |
| SMILES | Cc1ccccn1.Cc1ccccn1.Cl[Pt]Cl |
| InChI | InChI=1S/2C6H7N.2ClH.Pt/c2*1-6-4-2-3-5-7-6;;;/h2*2-5H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | VLYFSLAEQRERHM-UHFFFAOYSA-L |
| XLogP | 4.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloroplatinum;bis(2-methylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;bis(2-methylpyridine)?
The IUPAC name of dichloroplatinum;bis(2-methylpyridine) (CID 4034453) is dichloroplatinum;bis(2-methylpyridine).
What is the SMILES notation for dichloroplatinum;bis(2-methylpyridine)?
The canonical SMILES for dichloroplatinum;bis(2-methylpyridine) is Cc1ccccn1.Cc1ccccn1.Cl[Pt]Cl.
What is the InChIKey of dichloroplatinum;bis(2-methylpyridine)?
The InChIKey is VLYFSLAEQRERHM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H7N.2ClH.Pt/c2*1-6-4-2-3-5-7-6;;;/h2*2-5H,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroplatinum;bis(2-methylpyridine)?
dichloroplatinum;bis(2-methylpyridine) has a molecular weight of 452.24 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;bis(2-methylpyridine) is sourced from PubChem (CID 4034453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).