About 2-butan-2-ylpyrimidine;2-methylpyridine
2-butan-2-ylpyrimidine;2-methylpyridine (PubChem CID 142961647) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-butan-2-ylpyrimidine;2-methylpyridine.
Molecular Properties
| Compound Name | 2-butan-2-ylpyrimidine;2-methylpyridine |
| PubChem CID | 142961647 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-butan-2-ylpyrimidine;2-methylpyridine |
| SMILES | CCC(C)c1ncccn1.Cc1ccccn1 |
| InChI | InChI=1S/C8H12N2.C6H7N/c1-3-7(2)8-9-5-4-6-10-8;1-6-4-2-3-5-7-6/h4-7H,3H2,1-2H3;2-5H,1H3 |
| InChIKey | BFHGJOXFQYKARA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-ylpyrimidine;2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylpyrimidine;2-methylpyridine?
The IUPAC name of 2-butan-2-ylpyrimidine;2-methylpyridine (CID 142961647) is 2-butan-2-ylpyrimidine;2-methylpyridine.
What is the SMILES notation for 2-butan-2-ylpyrimidine;2-methylpyridine?
The canonical SMILES for 2-butan-2-ylpyrimidine;2-methylpyridine is CCC(C)c1ncccn1.Cc1ccccn1.
What is the InChIKey of 2-butan-2-ylpyrimidine;2-methylpyridine?
The InChIKey is BFHGJOXFQYKARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C6H7N/c1-3-7(2)8-9-5-4-6-10-8;1-6-4-2-3-5-7-6/h4-7H,3H2,1-2H3;2-5H,1H3.
What are the key properties of 2-butan-2-ylpyrimidine;2-methylpyridine?
2-butan-2-ylpyrimidine;2-methylpyridine has a molecular weight of 229.33 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylpyrimidine;2-methylpyridine is sourced from PubChem (CID 142961647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).