C9H6ClNOS — CID 45077000
2-methyl-1,3-benzothiazole-5-carbonyl chloride (PubChem CID 45077000) has the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. Its IUPAC name is 2-methyl-1,3-benzothiazole-5-carbonyl chloride.
| Compound Name | 2-methyl-1,3-benzothiazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 45077000 |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 2-methyl-1,3-benzothiazole-5-carbonyl chloride |
| SMILES | Cc1nc2cc(C(=O)Cl)ccc2s1 |
| InChI | InChI=1S/C9H6ClNOS/c1-5-11-7-4-6(9(10)12)2-3-8(7)13-5/h2-4H,1H3 |
| InChIKey | BTOBOYIMKDJJED-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|