C11H9F2NO2S — CID 83854965
4-(1,3-benzothiazol-2-yl)-4,4-difluorobutanoic acid (PubChem CID 83854965) has the molecular formula C11H9F2NO2S and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-4,4-difluorobutanoic acid.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-4,4-difluorobutanoic acid |
|---|---|
| PubChem CID | 83854965 |
| Molecular Formula | C11H9F2NO2S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-4,4-difluorobutanoic acid |
| SMILES | O=C(O)CCC(F)(F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9F2NO2S/c12-11(13,6-5-9(15)16)10-14-7-3-1-2-4-8(7)17-10/h1-4H,5-6H2,(H,15,16) |
| InChIKey | TXOSLYCIKKHIMR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |