C9H4F3NO2S — CID 91149401
1,3-benzothiazol-2-yl 2,2,2-trifluoroacetate (PubChem CID 91149401) has the molecular formula C9H4F3NO2S and a molecular weight of 247.20 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl 2,2,2-trifluoroacetate.
| Compound Name | 1,3-benzothiazol-2-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91149401 |
| Molecular Formula | C9H4F3NO2S |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 1,3-benzothiazol-2-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1nc2ccccc2s1)C(F)(F)F |
| InChI | InChI=1S/C9H4F3NO2S/c10-9(11,12)7(14)15-8-13-5-3-1-2-4-6(5)16-8/h1-4H |
| InChIKey | XFRWFZGTIQEEEI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |