C7H5NO3S2 — CID 57059233
1,3-benzothiazol-2-yl hydrogen sulfite (PubChem CID 57059233) has the molecular formula C7H5NO3S2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl hydrogen sulfite.
| Compound Name | 1,3-benzothiazol-2-yl hydrogen sulfite |
|---|---|
| PubChem CID | 57059233 |
| Molecular Formula | C7H5NO3S2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 1,3-benzothiazol-2-yl hydrogen sulfite |
| SMILES | O=S(O)Oc1nc2ccccc2s1 |
| InChI | InChI=1S/C7H5NO3S2/c9-13(10)11-7-8-5-3-1-2-4-6(5)12-7/h1-4H,(H,9,10) |
| InChIKey | OARDLYMVMFQBRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|