C10H10NO3PS2 — CID 89147543
1-[1,3-benzothiazol-2-yloxy(methoxy)phosphoryl]ethanethione (PubChem CID 89147543) has the molecular formula C10H10NO3PS2 and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-[1,3-benzothiazol-2-yloxy(methoxy)phosphoryl]ethanethione.
| Compound Name | 1-[1,3-benzothiazol-2-yloxy(methoxy)phosphoryl]ethanethione |
|---|---|
| PubChem CID | 89147543 |
| Molecular Formula | C10H10NO3PS2 |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 1-[1,3-benzothiazol-2-yloxy(methoxy)phosphoryl]ethanethione |
| SMILES | COP(=O)(Oc1nc2ccccc2s1)C(C)=S |
| InChI | InChI=1S/C10H10NO3PS2/c1-7(16)15(12,13-2)14-10-11-8-5-3-4-6-9(8)17-10/h3-6H,1-2H3 |
| InChIKey | AJQHIXLFLOEJPJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|