C14H15N4O4PS2 — CID 175581696
bis(1,3-benzothiazol-2-amine);phosphoric acid (PubChem CID 175581696) has the molecular formula C14H15N4O4PS2 and a molecular weight of 398.41 g/mol. Its IUPAC name is bis(1,3-benzothiazol-2-amine);phosphoric acid.
| Compound Name | bis(1,3-benzothiazol-2-amine);phosphoric acid |
|---|---|
| PubChem CID | 175581696 |
| Molecular Formula | C14H15N4O4PS2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | bis(1,3-benzothiazol-2-amine);phosphoric acid |
| SMILES | Nc1nc2ccccc2s1.Nc1nc2ccccc2s1.O=P(O)(O)O |
| InChI | InChI=1S/2C7H6N2S.H3O4P/c2*8-7-9-5-3-1-2-4-6(5)10-7;1-5(2,3)4/h2*1-4H,(H2,8,9);(H3,1,2,3,4) |
| InChIKey | GWLQQRNOUFBLAI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|