C19H20N4S2 — CID 159847568
2-aminobenzenethiol;aniline;1,3-benzothiazol-2-amine (PubChem CID 159847568) has the molecular formula C19H20N4S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-aminobenzenethiol;aniline;1,3-benzothiazol-2-amine.
| Compound Name | 2-aminobenzenethiol;aniline;1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 159847568 |
| Molecular Formula | C19H20N4S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-aminobenzenethiol;aniline;1,3-benzothiazol-2-amine |
| SMILES | Nc1ccccc1.Nc1ccccc1S.Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C7H6N2S.C6H7NS.C6H7N/c8-7-9-5-3-1-2-4-6(5)10-7;7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4H,(H2,8,9);1-4,8H,7H2;1-5H,7H2 |
| InChIKey | NPMXLMHNWAJEIQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|