C24H32N4O2S2 — CID 158462930
2-aminobenzenethiol;piperidine-4-carboxylic acid;2-piperidin-4-yl-1,3-benzothiazole (PubChem CID 158462930) has the molecular formula C24H32N4O2S2 and a molecular weight of 472.68 g/mol. Its IUPAC name is 2-aminobenzenethiol;piperidine-4-carboxylic acid;2-piperidin-4-yl-1,3-benzothiazole.
| Compound Name | 2-aminobenzenethiol;piperidine-4-carboxylic acid;2-piperidin-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 158462930 |
| Molecular Formula | C24H32N4O2S2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-aminobenzenethiol;piperidine-4-carboxylic acid;2-piperidin-4-yl-1,3-benzothiazole |
| SMILES | Nc1ccccc1S.O=C(O)C1CCNCC1.c1ccc2sc(C3CCNCC3)nc2c1 |
| InChI | InChI=1S/C12H14N2S.C6H11NO2.C6H7NS/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9;8-6(9)5-1-3-7-4-2-5;7-5-3-1-2-4-6(5)8/h1-4,9,13H,5-8H2;5,7H,1-4H2,(H,8,9);1-4,8H,7H2 |
| InChIKey | HFKFQDZBZDTOMN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|