C12H12N2O2S — CID 66838715
(2S)-3-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 66838715) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is (2S)-3-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-3-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66838715 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (2S)-3-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1NCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12N2O2S/c15-12(16)10-7(5-6-13-10)11-14-8-3-1-2-4-9(8)17-11/h1-4,7,10,13H,5-6H2,(H,15,16)/t7?,10-/m0/s1 |
| InChIKey | IXICCGYDRQHAKX-MHPPCMCBSA-N |
| XLogP | 1.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |