C18H19N3O2S — CID 94097312
4-[(1R,6S)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]piperazin-2-one (PubChem CID 94097312) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[(1R,6S)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]piperazin-2-one.
| Compound Name | 4-[(1R,6S)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 94097312 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[(1R,6S)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)[C@@H]2CC=CC[C@@H]2c2nc3ccccc3s2)CCN1 |
| InChI | InChI=1S/C18H19N3O2S/c22-16-11-21(10-9-19-16)18(23)13-6-2-1-5-12(13)17-20-14-7-3-4-8-15(14)24-17/h1-4,7-8,12-13H,5-6,9-11H2,(H,19,22)/t12-,13+/m0/s1 |
| InChIKey | AWOGKLZZEZHQER-QWHCGFSZSA-N |
| XLogP | 2.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|