C19H25Cl2N3OS — CID 119484423
[3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone;dihydrochloride (PubChem CID 119484423) has the molecular formula C19H25Cl2N3OS and a molecular weight of 414.40 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone;dihydrochloride.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119484423 |
| Molecular Formula | C19H25Cl2N3OS |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCN(C(=O)C2CC=CCC2c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C19H23N3OS.2ClH/c20-11-13-9-10-22(12-13)19(23)15-6-2-1-5-14(15)18-21-16-7-3-4-8-17(16)24-18;;/h1-4,7-8,13-15H,5-6,9-12,20H2;2*1H |
| InChIKey | SSNYEPPMFBCNSJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|