C19H23N3OS — CID 119484424
[3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone (PubChem CID 119484424) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone |
|---|---|
| PubChem CID | 119484424 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]methanone |
| SMILES | NCC1CCN(C(=O)C2CC=CCC2c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C19H23N3OS/c20-11-13-9-10-22(12-13)19(23)15-6-2-1-5-14(15)18-21-16-7-3-4-8-17(16)24-18/h1-4,7-8,13-15H,5-6,9-12,20H2 |
| InChIKey | BLOWKLLIQXCUFU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|