C19H22N2OS2 — CID 86839907
[6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-(1,4-thiazepan-4-yl)methanone (PubChem CID 86839907) has the molecular formula C19H22N2OS2 and a molecular weight of 358.53 g/mol. Its IUPAC name is [6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-(1,4-thiazepan-4-yl)methanone.
| Compound Name | [6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 86839907 |
| Molecular Formula | C19H22N2OS2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-(1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(C1CC=CCC1c1nc2ccccc2s1)N1CCCSCC1 |
| InChI | InChI=1S/C19H22N2OS2/c22-19(21-10-5-12-23-13-11-21)15-7-2-1-6-14(15)18-20-16-8-3-4-9-17(16)24-18/h1-4,8-9,14-15H,5-7,10-13H2 |
| InChIKey | DANFZNYPNKUXAG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|