C20H24N2O2S — CID 124828914
[(1R,6R)-6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 124828914) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is [(1R,6R)-6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [(1R,6R)-6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124828914 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(1R,6R)-6-(1,3-benzothiazol-2-yl)cyclohex-3-en-1-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2CC=CC[C@H]2c2nc3ccccc3s2)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H24N2O2S/c1-13-11-22(12-14(2)24-13)20(23)16-8-4-3-7-15(16)19-21-17-9-5-6-10-18(17)25-19/h3-6,9-10,13-16H,7-8,11-12H2,1-2H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | ODTDXCOKXATKRY-KLHDSHLOSA-N |
| XLogP | 3.98 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|