C18H23N3OS — CID 119627156
N-(2-amino-2-methylpropyl)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 119627156) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(2-amino-2-methylpropyl)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 119627156 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC(C)(N)CNC(=O)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H23N3OS/c1-18(2,19)11-20-16(22)12-7-3-4-8-13(12)17-21-14-9-5-6-10-15(14)23-17/h3-6,9-10,12-13H,7-8,11,19H2,1-2H3,(H,20,22) |
| InChIKey | OHIFLPNNAILBPB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|