C22H21F3N4OS — CID 55617673
6-(1,3-benzothiazol-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 55617673) has the molecular formula C22H21F3N4OS and a molecular weight of 446.50 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 55617673 |
| Molecular Formula | C22H21F3N4OS |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cn1)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H21F3N4OS/c23-22(24,25)14-9-10-19(28-13-14)26-11-12-27-20(30)15-5-1-2-6-16(15)21-29-17-7-3-4-8-18(17)31-21/h1-4,7-10,13,15-16H,5-6,11-12H2,(H,26,28)(H,27,30) |
| InChIKey | JZYQDDZGIKRLIA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|