C19H17F6N3O — CID 86935010
2-[3-(trifluoromethyl)phenyl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropane-1-carboxamide (PubChem CID 86935010) has the molecular formula C19H17F6N3O and a molecular weight of 417.35 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86935010 |
| Molecular Formula | C19H17F6N3O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cn1)C1CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6N3O/c20-18(21,22)12-3-1-2-11(8-12)14-9-15(14)17(29)27-7-6-26-16-5-4-13(10-28-16)19(23,24)25/h1-5,8,10,14-15H,6-7,9H2,(H,26,28)(H,27,29) |
| InChIKey | CWWTXVBWSPHCKM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|