C20H27F3N2O — CID 86935043
N-[3-(3-methylpiperidin-1-yl)propyl]-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 86935043) has the molecular formula C20H27F3N2O and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[3-(3-methylpiperidin-1-yl)propyl]-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-[3-(3-methylpiperidin-1-yl)propyl]-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86935043 |
| Molecular Formula | C20H27F3N2O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-[3-(3-methylpiperidin-1-yl)propyl]-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)C2CC2c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H27F3N2O/c1-14-5-3-9-25(13-14)10-4-8-24-19(26)18-12-17(18)15-6-2-7-16(11-15)20(21,22)23/h2,6-7,11,14,17-18H,3-5,8-10,12-13H2,1H3,(H,24,26) |
| InChIKey | BTZKRJKUDXMQQD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|