C22H31F3N2O2 — CID 42825952
N-butyl-1-(3,3-dimethylbutanoyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 42825952) has the molecular formula C22H31F3N2O2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-butyl-1-(3,3-dimethylbutanoyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-butyl-1-(3,3-dimethylbutanoyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42825952 |
| Molecular Formula | C22H31F3N2O2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N-butyl-1-(3,3-dimethylbutanoyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CN(C(=O)CC(C)(C)C)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H31F3N2O2/c1-5-6-10-26-20(29)18-14-27(19(28)12-21(2,3)4)13-17(18)15-8-7-9-16(11-15)22(23,24)25/h7-9,11,17-18H,5-6,10,12-14H2,1-4H3,(H,26,29) |
| InChIKey | XFMOSTVDXBBYKZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|