C20H27F3N2O2 — CID 42680382
N-(3-methylbutyl)-1-propanoyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 42680382) has the molecular formula C20H27F3N2O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(3-methylbutyl)-1-propanoyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-(3-methylbutyl)-1-propanoyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42680382 |
| Molecular Formula | C20H27F3N2O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(3-methylbutyl)-1-propanoyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CCC(=O)N1CC(C(=O)NCCC(C)C)C(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H27F3N2O2/c1-4-18(26)25-11-16(14-6-5-7-15(10-14)20(21,22)23)17(12-25)19(27)24-9-8-13(2)3/h5-7,10,13,16-17H,4,8-9,11-12H2,1-3H3,(H,24,27) |
| InChIKey | DXPZFSGRBFDXDG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |