C23H24F4N2O3 — CID 71956432
1-(2-fluorobenzoyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 71956432) has the molecular formula C23H24F4N2O3 and a molecular weight of 452.45 g/mol. Its IUPAC name is 1-(2-fluorobenzoyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-fluorobenzoyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71956432 |
| Molecular Formula | C23H24F4N2O3 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-(2-fluorobenzoyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)C1CN(C(=O)c2ccccc2F)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F4N2O3/c1-32-11-5-10-28-21(30)19-14-29(22(31)17-8-2-3-9-20(17)24)13-18(19)15-6-4-7-16(12-15)23(25,26)27/h2-4,6-9,12,18-19H,5,10-11,13-14H2,1H3,(H,28,30) |
| InChIKey | AHOVKGMCRLCKSC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|