C23H27FN2O5 — CID 93154103
(3R,4S)-4-(2,4-dimethoxyphenyl)-1-(2-fluorobenzoyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide (PubChem CID 93154103) has the molecular formula C23H27FN2O5 and a molecular weight of 430.48 g/mol. Its IUPAC name is (3R,4S)-4-(2,4-dimethoxyphenyl)-1-(2-fluorobenzoyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-(2,4-dimethoxyphenyl)-1-(2-fluorobenzoyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93154103 |
| Molecular Formula | C23H27FN2O5 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (3R,4S)-4-(2,4-dimethoxyphenyl)-1-(2-fluorobenzoyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CN(C(=O)c2ccccc2F)C[C@@H]1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H27FN2O5/c1-29-11-10-25-22(27)19-14-26(23(28)17-6-4-5-7-20(17)24)13-18(19)16-9-8-15(30-2)12-21(16)31-3/h4-9,12,18-19H,10-11,13-14H2,1-3H3,(H,25,27)/t18-,19+/m1/s1 |
| InChIKey | OJCIINPDAIEWQV-MOPGFXCFSA-N |
| XLogP | 2.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|