C25H32N2O5 — CID 93150647
(3S,4S)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide (PubChem CID 93150647) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (3S,4S)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150647 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (3S,4S)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CN(C(=O)c2ccccc2C)C[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H32N2O5/c1-17-8-5-6-9-19(17)25(29)27-15-21(20-14-18(31-3)10-11-23(20)32-4)22(16-27)24(28)26-12-7-13-30-2/h5-6,8-11,14,21-22H,7,12-13,15-16H2,1-4H3,(H,26,28)/t21-,22-/m1/s1 |
| InChIKey | BTZBDMAXAUQYKU-FGZHOGPDSA-N |
| XLogP | 3.02 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|