C21H30N2O5 — CID 93150633
(3S,4R)-1-(cyclopropanecarbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide (PubChem CID 93150633) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is (3S,4R)-1-(cyclopropanecarbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-(cyclopropanecarbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150633 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (3S,4R)-1-(cyclopropanecarbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CN(C(=O)C2CC2)C[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H30N2O5/c1-26-10-4-9-22-20(24)18-13-23(21(25)14-5-6-14)12-17(18)16-11-15(27-2)7-8-19(16)28-3/h7-8,11,14,17-18H,4-6,9-10,12-13H2,1-3H3,(H,22,24)/t17-,18+/m0/s1 |
| InChIKey | LEPGKXNCBOWYHR-ZWKOTPCHSA-N |
| XLogP | 1.81 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|