C25H32N2O6 — CID 93150626
(3R,4R)-4-(2,5-dimethoxyphenyl)-1-(4-methoxybenzoyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide (PubChem CID 93150626) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3R,4R)-4-(2,5-dimethoxyphenyl)-1-(4-methoxybenzoyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-4-(2,5-dimethoxyphenyl)-1-(4-methoxybenzoyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150626 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3R,4R)-4-(2,5-dimethoxyphenyl)-1-(4-methoxybenzoyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CN(C(=O)c2ccc(OC)cc2)C[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H32N2O6/c1-30-13-5-12-26-24(28)22-16-27(25(29)17-6-8-18(31-2)9-7-17)15-21(22)20-14-19(32-3)10-11-23(20)33-4/h6-11,14,21-22H,5,12-13,15-16H2,1-4H3,(H,26,28)/t21-,22-/m0/s1 |
| InChIKey | CRNADVZRPDJLRC-VXKWHMMOSA-N |
| XLogP | 2.72 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|