C23H28N2O4 — CID 93152787
(3S,4R)-1-benzoyl-4-(2-methoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide (PubChem CID 93152787) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3S,4R)-1-benzoyl-4-(2-methoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-benzoyl-4-(2-methoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93152787 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (3S,4R)-1-benzoyl-4-(2-methoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CN(C(=O)c2ccccc2)C[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C23H28N2O4/c1-28-14-8-13-24-22(26)20-16-25(23(27)17-9-4-3-5-10-17)15-19(20)18-11-6-7-12-21(18)29-2/h3-7,9-12,19-20H,8,13-16H2,1-2H3,(H,24,26)/t19-,20+/m0/s1 |
| InChIKey | VBQRDVLFMHOUAL-VQTJNVASSA-N |
| XLogP | 2.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|