C24H29FN2O3 — CID 42829632
1-(4-fluorobenzoyl)-4-(2-methoxyphenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide (PubChem CID 42829632) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-4-(2-methoxyphenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-4-(2-methoxyphenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42829632 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-(4-fluorobenzoyl)-4-(2-methoxyphenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1C1CN(C(=O)c2ccc(F)cc2)CC1C(=O)NCCC(C)C |
| InChI | InChI=1S/C24H29FN2O3/c1-16(2)12-13-26-23(28)21-15-27(24(29)17-8-10-18(25)11-9-17)14-20(21)19-6-4-5-7-22(19)30-3/h4-11,16,20-21H,12-15H2,1-3H3,(H,26,28) |
| InChIKey | CNZINOIHCFALJH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |