C25H32N2O4 — CID 93150796
(3R,4S)-N-butyl-4-(2,5-dimethoxyphenyl)-1-(4-methylbenzoyl)pyrrolidine-3-carboxamide (PubChem CID 93150796) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (3R,4S)-N-butyl-4-(2,5-dimethoxyphenyl)-1-(4-methylbenzoyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-butyl-4-(2,5-dimethoxyphenyl)-1-(4-methylbenzoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150796 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (3R,4S)-N-butyl-4-(2,5-dimethoxyphenyl)-1-(4-methylbenzoyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CN(C(=O)c2ccc(C)cc2)C[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H32N2O4/c1-5-6-13-26-24(28)22-16-27(25(29)18-9-7-17(2)8-10-18)15-21(22)20-14-19(30-3)11-12-23(20)31-4/h7-12,14,21-22H,5-6,13,15-16H2,1-4H3,(H,26,28)/t21-,22+/m1/s1 |
| InChIKey | PPHPAXOAAJMJEU-YADHBBJMSA-N |
| XLogP | 3.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|