C25H30N2O7 — CID 46144728
1-(1,3-benzodioxole-5-carbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide (PubChem CID 46144728) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46144728 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-4-(2,5-dimethoxyphenyl)-N-(3-methoxypropyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)C1CN(C(=O)c2ccc3c(c2)OCO3)CC1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H30N2O7/c1-30-10-4-9-26-24(28)20-14-27(25(29)16-5-7-22-23(11-16)34-15-33-22)13-19(20)18-12-17(31-2)6-8-21(18)32-3/h5-8,11-12,19-20H,4,9-10,13-15H2,1-3H3,(H,26,28) |
| InChIKey | FLMPWAAGDAAEDZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|