C24H25F3N2O5 — CID 42680356
1-(1,3-benzodioxole-5-carbonyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 42680356) has the molecular formula C24H25F3N2O5 and a molecular weight of 478.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42680356 |
| Molecular Formula | C24H25F3N2O5 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)C1CN(C(=O)c2ccc3c(c2)OCO3)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N2O5/c1-32-9-3-8-28-22(30)19-13-29(23(31)16-6-7-20-21(11-16)34-14-33-20)12-18(19)15-4-2-5-17(10-15)24(25,26)27/h2,4-7,10-11,18-19H,3,8-9,12-14H2,1H3,(H,28,30) |
| InChIKey | MKRZEZYHDBDTKK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|