C23H25FN2O4 — CID 93151586
(3R,4S)-1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(4-fluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 93151586) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is (3R,4S)-1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(4-fluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(4-fluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93151586 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (3R,4S)-1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(4-fluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CN(C(=O)c2ccc3c(c2)OCO3)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN2O4/c1-2-3-10-25-22(27)19-13-26(12-18(19)15-4-7-17(24)8-5-15)23(28)16-6-9-20-21(11-16)30-14-29-20/h4-9,11,18-19H,2-3,10,12-14H2,1H3,(H,25,27)/t18-,19+/m1/s1 |
| InChIKey | OYVSFRZGWBEDSV-MOPGFXCFSA-N |
| XLogP | 3.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|