C19H28FN3OS — CID 93151637
(3S,4S)-N-butyl-4-(4-fluorophenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide (PubChem CID 93151637) has the molecular formula C19H28FN3OS and a molecular weight of 365.52 g/mol. Its IUPAC name is (3S,4S)-N-butyl-4-(4-fluorophenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-butyl-4-(4-fluorophenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93151637 |
| Molecular Formula | C19H28FN3OS |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (3S,4S)-N-butyl-4-(4-fluorophenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CN(C(=S)NC(C)C)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H28FN3OS/c1-4-5-10-21-18(24)17-12-23(19(25)22-13(2)3)11-16(17)14-6-8-15(20)9-7-14/h6-9,13,16-17H,4-5,10-12H2,1-3H3,(H,21,24)(H,22,25)/t16-,17-/m1/s1 |
| InChIKey | OLPNUUATNHYSMJ-IAGOWNOFSA-N |
| XLogP | 3.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|