C22H35N3O4S — CID 93150396
(3R,4R)-N-butyl-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 93150396) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is (3R,4R)-N-butyl-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-butyl-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150396 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (3R,4R)-N-butyl-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CN(C(=S)NC(C)C)C[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H35N3O4S/c1-7-8-9-23-21(26)17-13-25(22(30)24-14(2)3)12-16(17)15-10-18(27-4)20(29-6)19(11-15)28-5/h10-11,14,16-17H,7-9,12-13H2,1-6H3,(H,23,26)(H,24,30)/t16-,17-/m0/s1 |
| InChIKey | VXVDGSPJZDCPTA-IRXDYDNUSA-N |
| XLogP | 2.93 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|