C22H35N3O5 — CID 93150355
(3S,4R)-3-N-butyl-1-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 93150355) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3S,4R)-3-N-butyl-1-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S,4R)-3-N-butyl-1-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93150355 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (3S,4R)-3-N-butyl-1-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CN(C(=O)NC(C)C)C[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H35N3O5/c1-7-8-9-23-21(26)17-13-25(22(27)24-14(2)3)12-16(17)15-10-18(28-4)20(30-6)19(11-15)29-5/h10-11,14,16-17H,7-9,12-13H2,1-6H3,(H,23,26)(H,24,27)/t16-,17+/m0/s1 |
| InChIKey | JWQTWILYIXMZGG-DLBZAZTESA-N |
| XLogP | 2.76 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|