C23H36N2O5 — CID 42826329
N-butyl-1-(3-methylbutanoyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 42826329) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-butyl-1-(3-methylbutanoyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-butyl-1-(3-methylbutanoyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42826329 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N-butyl-1-(3-methylbutanoyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CN(C(=O)CC(C)C)CC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H36N2O5/c1-7-8-9-24-23(27)18-14-25(21(26)10-15(2)3)13-17(18)16-11-19(28-4)22(30-6)20(12-16)29-5/h11-12,15,17-18H,7-10,13-14H2,1-6H3,(H,24,27) |
| InChIKey | YVEDEKGRRUREGF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|