C20H29FN2O2 — CID 42829611
N-butyl-4-(3-fluorophenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide (PubChem CID 42829611) has the molecular formula C20H29FN2O2 and a molecular weight of 348.46 g/mol. Its IUPAC name is N-butyl-4-(3-fluorophenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide.
| Compound Name | N-butyl-4-(3-fluorophenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42829611 |
| Molecular Formula | C20H29FN2O2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-butyl-4-(3-fluorophenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CN(C(=O)CC(C)C)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C20H29FN2O2/c1-4-5-9-22-20(25)18-13-23(19(24)10-14(2)3)12-17(18)15-7-6-8-16(21)11-15/h6-8,11,14,17-18H,4-5,9-10,12-13H2,1-3H3,(H,22,25) |
| InChIKey | REJYWNWEZLDHCU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|