C20H30FN3OS — CID 93152955
(3S,4R)-4-(3-fluorophenyl)-N-(3-methylbutyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide (PubChem CID 93152955) has the molecular formula C20H30FN3OS and a molecular weight of 379.55 g/mol. Its IUPAC name is (3S,4R)-4-(3-fluorophenyl)-N-(3-methylbutyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-(3-fluorophenyl)-N-(3-methylbutyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93152955 |
| Molecular Formula | C20H30FN3OS |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (3S,4R)-4-(3-fluorophenyl)-N-(3-methylbutyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@@H]1CN(C(=S)NC(C)C)C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C20H30FN3OS/c1-13(2)8-9-22-19(25)18-12-24(20(26)23-14(3)4)11-17(18)15-6-5-7-16(21)10-15/h5-7,10,13-14,17-18H,8-9,11-12H2,1-4H3,(H,22,25)(H,23,26)/t17-,18+/m0/s1 |
| InChIKey | XHINNXMMYVYAOH-ZWKOTPCHSA-N |
| XLogP | 3.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|