C23H26F2N2O2 — CID 42681313
1-(2-fluorobenzoyl)-4-(3-fluorophenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide (PubChem CID 42681313) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-(2-fluorobenzoyl)-4-(3-fluorophenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-fluorobenzoyl)-4-(3-fluorophenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681313 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-(2-fluorobenzoyl)-4-(3-fluorophenyl)-N-(3-methylbutyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)CCNC(=O)C1CN(C(=O)c2ccccc2F)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C23H26F2N2O2/c1-15(2)10-11-26-22(28)20-14-27(23(29)18-8-3-4-9-21(18)25)13-19(20)16-6-5-7-17(24)12-16/h3-9,12,15,19-20H,10-11,13-14H2,1-2H3,(H,26,28) |
| InChIKey | QTLHFRBOJNKYCP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |